C20H32FN3O3S — CID 123488689
ethyl 4-[[(2R)-4-(2-fluoroethylamino)-1-phenylsulfanylbutan-2-yl]amino]oxypiperidine-1-carboxylate (PubChem CID 123488689) has the molecular formula C20H32FN3O3S and a molecular weight of 413.56 g/mol. Its IUPAC name is ethyl 4-[[(2R)-4-(2-fluoroethylamino)-1-phenylsulfanylbutan-2-yl]amino]oxypiperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(2R)-4-(2-fluoroethylamino)-1-phenylsulfanylbutan-2-yl]amino]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123488689 |
| Molecular Formula | C20H32FN3O3S |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | ethyl 4-[[(2R)-4-(2-fluoroethylamino)-1-phenylsulfanylbutan-2-yl]amino]oxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(ON[C@H](CCNCCF)CSc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32FN3O3S/c1-2-26-20(25)24-14-9-18(10-15-24)27-23-17(8-12-22-13-11-21)16-28-19-6-4-3-5-7-19/h3-7,17-18,22-23H,2,8-16H2,1H3/t17-/m1/s1 |
| InChIKey | IPKPQDPAARPFJX-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|