C12H20N2S — CID 58080194
(3R)-1-N,1-N-dimethyl-4-phenylsulfanylbutane-1,3-diamine (PubChem CID 58080194) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is (3R)-1-N,1-N-dimethyl-4-phenylsulfanylbutane-1,3-diamine.
| Compound Name | (3R)-1-N,1-N-dimethyl-4-phenylsulfanylbutane-1,3-diamine |
|---|---|
| PubChem CID | 58080194 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (3R)-1-N,1-N-dimethyl-4-phenylsulfanylbutane-1,3-diamine |
| SMILES | CN(C)CC[C@@H](N)CSc1ccccc1 |
| InChI | InChI=1S/C12H20N2S/c1-14(2)9-8-11(13)10-15-12-6-4-3-5-7-12/h3-7,11H,8-10,13H2,1-2H3/t11-/m1/s1 |
| InChIKey | AMNYAHNHKFYZOU-LLVKDONJSA-N |
| XLogP | 2.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |