C19H31NO2S — CID 101089539
(2S,3S)-N-tert-butyl-3-hydroxy-2-(phenylsulfanylmethyl)octanamide (PubChem CID 101089539) has the molecular formula C19H31NO2S and a molecular weight of 337.53 g/mol. Its IUPAC name is (2S,3S)-N-tert-butyl-3-hydroxy-2-(phenylsulfanylmethyl)octanamide.
| Compound Name | (2S,3S)-N-tert-butyl-3-hydroxy-2-(phenylsulfanylmethyl)octanamide |
|---|---|
| PubChem CID | 101089539 |
| Molecular Formula | C19H31NO2S |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | (2S,3S)-N-tert-butyl-3-hydroxy-2-(phenylsulfanylmethyl)octanamide |
| SMILES | CCCCC[C@H](O)[C@H](CSc1ccccc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H31NO2S/c1-5-6-8-13-17(21)16(18(22)20-19(2,3)4)14-23-15-11-9-7-10-12-15/h7,9-12,16-17,21H,5-6,8,13-14H2,1-4H3,(H,20,22)/t16-,17-/m0/s1 |
| InChIKey | XYEOEANFONTOJQ-IRXDYDNUSA-N |
| XLogP | 4.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|