C18H27NO4S — CID 11842915
4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoic acid (PubChem CID 11842915) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11842915 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CC(O)C(C)(C)Sc1ccccc1 |
| InChI | InChI=1S/C18H27NO4S/c1-17(2,11-10-16(22)23)19-15(21)12-14(20)18(3,4)24-13-8-6-5-7-9-13/h5-9,14,20H,10-12H2,1-4H3,(H,19,21)(H,22,23) |
| InChIKey | AZXXCWVSPDNJDK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |