C15H20FNO3S — CID 62044157
4-[3-(4-fluorophenyl)sulfanylpropanoylamino]-4-methylpentanoic acid (PubChem CID 62044157) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)sulfanylpropanoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[3-(4-fluorophenyl)sulfanylpropanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 62044157 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[3-(4-fluorophenyl)sulfanylpropanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C15H20FNO3S/c1-15(2,9-7-14(19)20)17-13(18)8-10-21-12-5-3-11(16)4-6-12/h3-6H,7-10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | QDTUAOFIXBRDJE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |