C19H29NO4S — CID 11843229
methyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate (PubChem CID 11843229) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is methyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate.
| Compound Name | methyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11843229 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | methyl 4-[(3-hydroxy-4-methyl-4-phenylsulfanylpentanoyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)CCC(C)(C)NC(=O)CC(O)C(C)(C)Sc1ccccc1 |
| InChI | InChI=1S/C19H29NO4S/c1-18(2,12-11-17(23)24-5)20-16(22)13-15(21)19(3,4)25-14-9-7-6-8-10-14/h6-10,15,21H,11-13H2,1-5H3,(H,20,22) |
| InChIKey | RCSVVRHQBHKSSS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |