C16H28O2 — CID 101090101
(4E)-4-(2,2-dimethylpropylidene)-2-ethoxy-1-oxaspiro[4.5]decane (PubChem CID 101090101) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (4E)-4-(2,2-dimethylpropylidene)-2-ethoxy-1-oxaspiro[4.5]decane.
| Compound Name | (4E)-4-(2,2-dimethylpropylidene)-2-ethoxy-1-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 101090101 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (4E)-4-(2,2-dimethylpropylidene)-2-ethoxy-1-oxaspiro[4.5]decane |
| SMILES | CCOC1C/C(=C\C(C)(C)C)C2(CCCCC2)O1 |
| InChI | InChI=1S/C16H28O2/c1-5-17-14-11-13(12-15(2,3)4)16(18-14)9-7-6-8-10-16/h12,14H,5-11H2,1-4H3/b13-12+ |
| InChIKey | KNJFSUOGEDOZKR-OUKQBFOZSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|