C13H20O2 — CID 134858820
(8S)-7,9-dioxadispiro[5.1.58.26]pentadec-12-ene (PubChem CID 134858820) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (8S)-7,9-dioxadispiro[5.1.58.26]pentadec-12-ene.
| Compound Name | (8S)-7,9-dioxadispiro[5.1.58.26]pentadec-12-ene |
|---|---|
| PubChem CID | 134858820 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (8S)-7,9-dioxadispiro[5.1.58.26]pentadec-12-ene |
| SMILES | C1=C[C@@]2(CCC3(CCCCC3)O2)OCC1 |
| InChI | InChI=1S/C13H20O2/c1-2-6-12(7-3-1)9-10-13(15-12)8-4-5-11-14-13/h4,8H,1-3,5-7,9-11H2/t13-/m1/s1 |
| InChIKey | PPRSNZWCRSVBIH-CYBMUJFWSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|