C18H32O2 — CID 11173624
(4E)-2-butoxy-7,9-dideuterio-4-(1-deuterio-2,2-dimethylpropylidene)-1-oxaspiro[4.5]decane (PubChem CID 11173624) has the molecular formula C18H32O2 and a molecular weight of 283.47 g/mol. Its IUPAC name is (4E)-2-butoxy-7,9-dideuterio-4-(1-deuterio-2,2-dimethylpropylidene)-1-oxaspiro[4.5]decane.
| Compound Name | (4E)-2-butoxy-7,9-dideuterio-4-(1-deuterio-2,2-dimethylpropylidene)-1-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 11173624 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | (4E)-2-butoxy-7,9-dideuterio-4-(1-deuterio-2,2-dimethylpropylidene)-1-oxaspiro[4.5]decane |
| SMILES | [2H]/C(=C1/CC(OCCCC)OC12CC([2H])CC([2H])C2)C(C)(C)C |
| InChI | InChI=1S/C18H32O2/c1-5-6-12-19-16-13-15(14-17(2,3)4)18(20-16)10-8-7-9-11-18/h14,16H,5-13H2,1-4H3/b15-14+/i8D,9D,14D |
| InChIKey | XGUOMMHGCYFGEN-PMKQPZSQSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|