C18H13N3O5S — CID 101091727
4-(1-cyclopropyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)benzoic acid (PubChem CID 101091727) has the molecular formula C18H13N3O5S and a molecular weight of 383.39 g/mol. Its IUPAC name is 4-(1-cyclopropyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)benzoic acid.
| Compound Name | 4-(1-cyclopropyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 101091727 |
| Molecular Formula | C18H13N3O5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-(1-cyclopropyl-6-nitro-4-oxo-2-sulfanylidenequinazolin-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-n2c(=O)c3cc([N+](=O)[O-])ccc3n(C3CC3)c2=S)cc1 |
| InChI | InChI=1S/C18H13N3O5S/c22-16-14-9-13(21(25)26)7-8-15(14)19(11-5-6-11)18(27)20(16)12-3-1-10(2-4-12)17(23)24/h1-4,7-9,11H,5-6H2,(H,23,24) |
| InChIKey | MKBLBRIZUXAFEH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|