C11H12O2 — CID 101092394
(1R,5R,7S)-7-phenyl-2,6-dioxabicyclo[3.2.0]heptane (PubChem CID 101092394) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (1R,5R,7S)-7-phenyl-2,6-dioxabicyclo[3.2.0]heptane.
| Compound Name | (1R,5R,7S)-7-phenyl-2,6-dioxabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 101092394 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1R,5R,7S)-7-phenyl-2,6-dioxabicyclo[3.2.0]heptane |
| SMILES | c1ccc([C@@H]2O[C@@H]3CCO[C@H]32)cc1 |
| InChI | InChI=1S/C11H12O2/c1-2-4-8(5-3-1)10-11-9(13-10)6-7-12-11/h1-5,9-11H,6-7H2/t9-,10+,11-/m1/s1 |
| InChIKey | PAAWOMSOXYYIPD-OUAUKWLOSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |