C14H15N2O4+ — CID 135877972
(Z)-2-hydroxy-2-[(2S,3R)-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]ethenediazonium (PubChem CID 135877972) has the molecular formula C14H15N2O4+ and a molecular weight of 275.28 g/mol. Its IUPAC name is (Z)-2-hydroxy-2-[(2S,3R)-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]ethenediazonium.
| Compound Name | (Z)-2-hydroxy-2-[(2S,3R)-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]ethenediazonium |
|---|---|
| PubChem CID | 135877972 |
| Molecular Formula | C14H15N2O4+ |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (Z)-2-hydroxy-2-[(2S,3R)-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]oxiran-2-yl]ethenediazonium |
| SMILES | N#[N+]/C=C(\O)[C@H]1O[C@@H]1[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C14H14N2O4/c15-16-8-10(17)12-13(20-12)11-6-7-18-14(19-11)9-4-2-1-3-5-9/h1-5,8,11-14H,6-7H2/p+1/b10-8-/t11-,12+,13+,14-/m0/s1 |
| InChIKey | DIISRRAIGYXMCO-JRFSATCNSA-O |
| XLogP | 2.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|