C22H44O4Si — CID 101092613
methyl (1R,2S,5S)-2-(5-butan-2-yloxypentyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate (PubChem CID 101092613) has the molecular formula C22H44O4Si and a molecular weight of 400.68 g/mol. Its IUPAC name is methyl (1R,2S,5S)-2-(5-butan-2-yloxypentyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,5S)-2-(5-butan-2-yloxypentyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101092613 |
| Molecular Formula | C22H44O4Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | methyl (1R,2S,5S)-2-(5-butan-2-yloxypentyl)-5-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate |
| SMILES | CCC(C)OCCCCC[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H44O4Si/c1-9-17(2)25-16-12-10-11-13-18-14-15-19(20(18)21(23)24-6)26-27(7,8)22(3,4)5/h17-20H,9-16H2,1-8H3/t17?,18-,19-,20+/m0/s1 |
| InChIKey | WHCIIZNINNKUHN-SEBOWIOWSA-N |
| XLogP | 5.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|