About [diethoxy(hydroxy)silyl] diethyl methyl silicate
[diethoxy(hydroxy)silyl] diethyl methyl silicate (PubChem CID 101092888) has the molecular formula C9H24O7Si2
and a molecular weight of 300.46 g/mol. Its IUPAC name is [diethoxy(hydroxy)silyl] diethyl methyl silicate.
Molecular Properties
| Compound Name | [diethoxy(hydroxy)silyl] diethyl methyl silicate |
| PubChem CID | 101092888 |
| Molecular Formula | C9H24O7Si2 |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [diethoxy(hydroxy)silyl] diethyl methyl silicate |
| SMILES | CCO[Si](O)(OCC)O[Si](OC)(OCC)OCC |
| InChI | InChI=1S/C9H24O7Si2/c1-6-12-17(10,13-7-2)16-18(11-5,14-8-3)15-9-4/h10H,6-9H2,1-5H3 |
| InChIKey | BLGGBMPJCBMKIC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [diethoxy(hydroxy)silyl] diethyl methyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethoxy(hydroxy)silyl] diethyl methyl silicate?
The IUPAC name of [diethoxy(hydroxy)silyl] diethyl methyl silicate (CID 101092888) is [diethoxy(hydroxy)silyl] diethyl methyl silicate.
What is the SMILES notation for [diethoxy(hydroxy)silyl] diethyl methyl silicate?
The canonical SMILES for [diethoxy(hydroxy)silyl] diethyl methyl silicate is CCO[Si](O)(OCC)O[Si](OC)(OCC)OCC.
What is the InChIKey of [diethoxy(hydroxy)silyl] diethyl methyl silicate?
The InChIKey is BLGGBMPJCBMKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H24O7Si2/c1-6-12-17(10,13-7-2)16-18(11-5,14-8-3)15-9-4/h10H,6-9H2,1-5H3.
What are the key properties of [diethoxy(hydroxy)silyl] diethyl methyl silicate?
[diethoxy(hydroxy)silyl] diethyl methyl silicate has a molecular weight of 300.46 g/mol, XLogP of 0.66, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [diethoxy(hydroxy)silyl] diethyl methyl silicate is sourced from PubChem (CID 101092888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).