C18H19NO4 — CID 101093262
(1S,5R,6S,7R)-3-benzyl-5,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid (PubChem CID 101093262) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (1S,5R,6S,7R)-3-benzyl-5,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid.
| Compound Name | (1S,5R,6S,7R)-3-benzyl-5,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 101093262 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (1S,5R,6S,7R)-3-benzyl-5,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
| SMILES | C[C@@]12C=C[C@]3(CN(Cc4ccccc4)C(=O)[C@]3(C)[C@@H]1C(=O)O)O2 |
| InChI | InChI=1S/C18H19NO4/c1-16-8-9-18(23-16)11-19(10-12-6-4-3-5-7-12)15(22)17(18,2)13(16)14(20)21/h3-9,13H,10-11H2,1-2H3,(H,20,21)/t13-,16-,17+,18-/m1/s1 |
| InChIKey | RXWPFHCDLBJILX-NKGKWGDASA-N |
| XLogP | 1.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|