C15H24O4Si — CID 101094758
dimethyl (1R,4R)-5-(trimethylsilylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 101094758) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is dimethyl (1R,4R)-5-(trimethylsilylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,4R)-5-(trimethylsilylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101094758 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | dimethyl (1R,4R)-5-(trimethylsilylmethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)C1C(C(=O)OC)[C@H]2C[C@@H]1C=C2C[Si](C)(C)C |
| InChI | InChI=1S/C15H24O4Si/c1-18-14(16)12-9-6-10(8-20(3,4)5)11(7-9)13(12)15(17)19-2/h6,9,11-13H,7-8H2,1-5H3/t9-,11-,12?,13?/m0/s1 |
| InChIKey | GCOQEBIWWJQALX-FSDFLBQZSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|