C16H10ClF3N4O — CID 10109502
4-chloro-3-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]phenol (PubChem CID 10109502) has the molecular formula C16H10ClF3N4O and a molecular weight of 366.73 g/mol. Its IUPAC name is 4-chloro-3-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]phenol.
| Compound Name | 4-chloro-3-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 10109502 |
| Molecular Formula | C16H10ClF3N4O |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4-chloro-3-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]phenol |
| SMILES | Oc1ccc(Cl)c(Nc2cc(C(F)(F)F)nc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C16H10ClF3N4O/c17-11-2-1-10(25)7-12(11)22-14-8-13(16(18,19)20)23-15(24-14)9-3-5-21-6-4-9/h1-8,25H,(H,22,23,24) |
| InChIKey | YRRJWQJFPYNRJW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |