C17H12ClF3N4O — CID 10110345
N-(2-chloro-5-methoxyphenyl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 10110345) has the molecular formula C17H12ClF3N4O and a molecular weight of 380.76 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 10110345 |
| Molecular Formula | C17H12ClF3N4O |
| Molecular Weight | 380.76 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | COc1ccc(Cl)c(Nc2cc(C(F)(F)F)nc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C17H12ClF3N4O/c1-26-11-2-3-12(18)13(8-11)23-15-9-14(17(19,20)21)24-16(25-15)10-4-6-22-7-5-10/h2-9H,1H3,(H,23,24,25) |
| InChIKey | IQDUNQUQCWGICF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |