About tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate
tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 101097758) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate.
Analyze tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The IUPAC name of tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate (CID 101097758) is tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate.
What is the SMILES notation for tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The canonical SMILES for tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate is C[C@H]1OC(=O)OC[C@H]1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The InChIKey is BFVOYBPMOLIMHS-RNFRBKRXSA-N. The full InChI is InChI=1S/C10H16O5/c1-6-7(5-13-9(12)14-6)8(11)15-10(2,3)4/h6-7H,5H2,1-4H3/t6-,7-/m1/s1.
What are the key properties of tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate?
tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate has a molecular weight of 216.23 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4R,5R)-4-methyl-2-oxo-1,3-dioxane-5-carboxylate is sourced from PubChem (CID 101097758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).