C18H24O5Se — CID 11069381
tert-butyl (2R)-2-[(4R,5R)-5-methyl-2-oxo-1,3-dioxan-4-yl]-2-phenylselanylpropanoate (PubChem CID 11069381) has the molecular formula C18H24O5Se and a molecular weight of 399.35 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4R,5R)-5-methyl-2-oxo-1,3-dioxan-4-yl]-2-phenylselanylpropanoate.
| Compound Name | tert-butyl (2R)-2-[(4R,5R)-5-methyl-2-oxo-1,3-dioxan-4-yl]-2-phenylselanylpropanoate |
|---|---|
| PubChem CID | 11069381 |
| Molecular Formula | C18H24O5Se |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | tert-butyl (2R)-2-[(4R,5R)-5-methyl-2-oxo-1,3-dioxan-4-yl]-2-phenylselanylpropanoate |
| SMILES | C[C@@H]1COC(=O)O[C@H]1[C@@](C)([Se]c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24O5Se/c1-12-11-21-16(20)22-14(12)18(5,15(19)23-17(2,3)4)24-13-9-7-6-8-10-13/h6-10,12,14H,11H2,1-5H3/t12-,14-,18-/m1/s1 |
| InChIKey | MSLPCXBGCWOOBN-RVZJWNSFSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|