C25H39NO9 — CID 101098856
(1R,15S,16R,18R,21R,23S)-23-methoxy-8-(2-methoxyethyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane (PubChem CID 101098856) has the molecular formula C25H39NO9 and a molecular weight of 497.59 g/mol. Its IUPAC name is (1R,15S,16R,18R,21R,23S)-23-methoxy-8-(2-methoxyethyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane.
| Compound Name | (1R,15S,16R,18R,21R,23S)-23-methoxy-8-(2-methoxyethyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
|---|---|
| PubChem CID | 101098856 |
| Molecular Formula | C25H39NO9 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | (1R,15S,16R,18R,21R,23S)-23-methoxy-8-(2-methoxyethyl)-18-phenyl-2,5,11,14,17,19,22-heptaoxa-8-azatricyclo[13.8.0.016,21]tricosane |
| SMILES | COCCN1CCOCCO[C@@H]2[C@@H](OCCOCC1)[C@@H](OC)O[C@@H]1CO[C@@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C25H39NO9/c1-27-11-8-26-9-12-29-14-16-31-22-21-20(18-33-24(35-21)19-6-4-3-5-7-19)34-25(28-2)23(22)32-17-15-30-13-10-26/h3-7,20-25H,8-18H2,1-2H3/t20-,21-,22+,23-,24-,25+/m1/s1 |
| InChIKey | YJRDPPIZBKUOKF-YHYVJRSVSA-N |
| XLogP | 1.24 |
| TPSA | 86.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |