C10H12N3O2+ — CID 101101560
1,2,3-trimethyl-5-nitrobenzimidazol-1-ium (PubChem CID 101101560) has the molecular formula C10H12N3O2+ and a molecular weight of 206.22 g/mol. Its IUPAC name is 1,2,3-trimethyl-5-nitrobenzimidazol-1-ium.
| Compound Name | 1,2,3-trimethyl-5-nitrobenzimidazol-1-ium |
|---|---|
| PubChem CID | 101101560 |
| Molecular Formula | C10H12N3O2+ |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1,2,3-trimethyl-5-nitrobenzimidazol-1-ium |
| SMILES | Cc1n(C)c2cc([N+](=O)[O-])ccc2[n+]1C |
| InChI | InChI=1S/C10H12N3O2/c1-7-11(2)9-5-4-8(13(14)15)6-10(9)12(7)3/h4-6H,1-3H3/q+1 |
| InChIKey | XPVYHBZVGGSXJX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 51.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|