C20H9F5N3O4+ — CID 177117652
10-methyl-2,7-dinitro-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium (PubChem CID 177117652) has the molecular formula C20H9F5N3O4+ and a molecular weight of 450.30 g/mol. Its IUPAC name is 10-methyl-2,7-dinitro-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium.
| Compound Name | 10-methyl-2,7-dinitro-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium |
|---|---|
| PubChem CID | 177117652 |
| Molecular Formula | C20H9F5N3O4+ |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 10-methyl-2,7-dinitro-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium |
| SMILES | C[n+]1c2ccc([N+](=O)[O-])cc2c(-c2c(F)c(F)c(F)c(F)c2F)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H9F5N3O4/c1-26-12-4-2-8(27(29)30)6-10(12)14(11-7-9(28(31)32)3-5-13(11)26)15-16(21)18(23)20(25)19(24)17(15)22/h2-7H,1H3/q+1 |
| InChIKey | LTOCELAMBCOMQA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|