C12H9IN4O4 — CID 163333090
5-methyl-2,8-dinitropyrido[1,2-a]benzimidazol-5-ium iodide (PubChem CID 163333090) has the molecular formula C12H9IN4O4 and a molecular weight of 400.13 g/mol. Its IUPAC name is 5-methyl-2,8-dinitropyrido[1,2-a]benzimidazol-5-ium iodide.
| Compound Name | 5-methyl-2,8-dinitropyrido[1,2-a]benzimidazol-5-ium iodide |
|---|---|
| PubChem CID | 163333090 |
| Molecular Formula | C12H9IN4O4 |
| Molecular Weight | 400.13 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 5-methyl-2,8-dinitropyrido[1,2-a]benzimidazol-5-ium iodide |
| SMILES | C[n+]1c2ccc([N+](=O)[O-])cc2n2cc([N+](=O)[O-])ccc21.[I-] |
| InChI | InChI=1S/C12H9N4O4.HI/c1-13-10-4-2-8(15(17)18)6-11(10)14-7-9(16(19)20)3-5-12(13)14;/h2-7H,1H3;1H/q+1;/p-1 |
| InChIKey | WRSOJNLNZFXBEJ-UHFFFAOYSA-M |
| XLogP | -1.26 |
| TPSA | 94.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.13 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|