C32H34 — CID 101102131
5,6-bis(3-tert-butylphenyl)-1,2-dihydroacenaphthylene (PubChem CID 101102131) has the molecular formula C32H34 and a molecular weight of 418.62 g/mol. Its IUPAC name is 5,6-bis(3-tert-butylphenyl)-1,2-dihydroacenaphthylene.
| Compound Name | 5,6-bis(3-tert-butylphenyl)-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 101102131 |
| Molecular Formula | C32H34 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 5,6-bis(3-tert-butylphenyl)-1,2-dihydroacenaphthylene |
| SMILES | CC(C)(C)c1cccc(-c2ccc3c4c(ccc(-c5cccc(C(C)(C)C)c5)c24)CC3)c1 |
| InChI | InChI=1S/C32H34/c1-31(2,3)25-11-7-9-23(19-25)27-17-15-21-13-14-22-16-18-28(30(27)29(21)22)24-10-8-12-26(20-24)32(4,5)6/h7-12,15-20H,13-14H2,1-6H3 |
| InChIKey | VSIAVRINYCALTE-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |