C25H46O7P2 — CID 101102502
1,4-bis(diethoxyphosphorylmethyl)-2-(2-ethylhexyl)-5-methoxybenzene (PubChem CID 101102502) has the molecular formula C25H46O7P2 and a molecular weight of 520.58 g/mol. Its IUPAC name is 1,4-bis(diethoxyphosphorylmethyl)-2-(2-ethylhexyl)-5-methoxybenzene.
| Compound Name | 1,4-bis(diethoxyphosphorylmethyl)-2-(2-ethylhexyl)-5-methoxybenzene |
|---|---|
| PubChem CID | 101102502 |
| Molecular Formula | C25H46O7P2 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 1,4-bis(diethoxyphosphorylmethyl)-2-(2-ethylhexyl)-5-methoxybenzene |
| SMILES | CCCCC(CC)Cc1cc(CP(=O)(OCC)OCC)c(OC)cc1CP(=O)(OCC)OCC |
| InChI | InChI=1S/C25H46O7P2/c1-8-14-15-21(9-2)16-22-17-24(20-34(27,31-12-5)32-13-6)25(28-7)18-23(22)19-33(26,29-10-3)30-11-4/h17-18,21H,8-16,19-20H2,1-7H3 |
| InChIKey | CXVOETXEKAPREW-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|