C33H59O7P — CID 102485454
2-[4-(diethoxyphosphorylmethyl)-2,5-bis(2-ethylhexoxy)phenyl]-5,5-dimethyl-1,3-dioxane (PubChem CID 102485454) has the molecular formula C33H59O7P and a molecular weight of 598.80 g/mol. Its IUPAC name is 2-[4-(diethoxyphosphorylmethyl)-2,5-bis(2-ethylhexoxy)phenyl]-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-[4-(diethoxyphosphorylmethyl)-2,5-bis(2-ethylhexoxy)phenyl]-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 102485454 |
| Molecular Formula | C33H59O7P |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | 2-[4-(diethoxyphosphorylmethyl)-2,5-bis(2-ethylhexoxy)phenyl]-5,5-dimethyl-1,3-dioxane |
| SMILES | CCCCC(CC)COc1cc(C2OCC(C)(C)CO2)c(OCC(CC)CCCC)cc1CP(=O)(OCC)OCC |
| InChI | InChI=1S/C33H59O7P/c1-9-15-17-26(11-3)21-35-30-20-29(32-37-24-33(7,8)25-38-32)31(36-22-27(12-4)18-16-10-2)19-28(30)23-41(34,39-13-5)40-14-6/h19-20,26-27,32H,9-18,21-25H2,1-8H3 |
| InChIKey | VLSMFWGXKMGMDZ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|