C33H52NO5P — CID 132525222
N-[[4-(ditert-butylphosphorylmethoxy)phenyl]methyl]-3-(1,3-dioxolan-2-yl)-4-(2-ethylhexoxy)aniline (PubChem CID 132525222) has the molecular formula C33H52NO5P and a molecular weight of 573.76 g/mol. Its IUPAC name is N-[[4-(ditert-butylphosphorylmethoxy)phenyl]methyl]-3-(1,3-dioxolan-2-yl)-4-(2-ethylhexoxy)aniline.
| Compound Name | N-[[4-(ditert-butylphosphorylmethoxy)phenyl]methyl]-3-(1,3-dioxolan-2-yl)-4-(2-ethylhexoxy)aniline |
|---|---|
| PubChem CID | 132525222 |
| Molecular Formula | C33H52NO5P |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | N-[[4-(ditert-butylphosphorylmethoxy)phenyl]methyl]-3-(1,3-dioxolan-2-yl)-4-(2-ethylhexoxy)aniline |
| SMILES | CCCCC(CC)COc1ccc(NCc2ccc(OCP(=O)(C(C)(C)C)C(C)(C)C)cc2)cc1C1OCCO1 |
| InChI | InChI=1S/C33H52NO5P/c1-9-11-12-25(10-2)23-38-30-18-15-27(21-29(30)31-36-19-20-37-31)34-22-26-13-16-28(17-14-26)39-24-40(35,32(3,4)5)33(6,7)8/h13-18,21,25,31,34H,9-12,19-20,22-24H2,1-8H3 |
| InChIKey | CKLSMDKIWGYSNQ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|