About 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one
2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one (PubChem CID 101102984) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one.
Molecular Properties
| Compound Name | 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one |
| PubChem CID | 101102984 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one |
| SMILES | CCCCCCC1Cc2c(c3ccccc3[nH]c2=O)O1 |
| InChI | InChI=1S/C17H21NO2/c1-2-3-4-5-8-12-11-14-16(20-12)13-9-6-7-10-15(13)18-17(14)19/h6-7,9-10,12H,2-5,8,11H2,1H3,(H,18,19) |
| InChIKey | UQCVDUDSWRNWIX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one?
The IUPAC name of 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one (CID 101102984) is 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one.
What is the SMILES notation for 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one?
The canonical SMILES for 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one is CCCCCCC1Cc2c(c3ccccc3[nH]c2=O)O1.
What is the InChIKey of 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one?
The InChIKey is UQCVDUDSWRNWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2/c1-2-3-4-5-8-12-11-14-16(20-12)13-9-6-7-10-15(13)18-17(14)19/h6-7,9-10,12H,2-5,8,11H2,1H3,(H,18,19).
What are the key properties of 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one?
2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one has a molecular weight of 271.36 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one is sourced from PubChem (CID 101102984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).