C17H21NO2 — CID 101102984
2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one (PubChem CID 101102984) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one.
| Compound Name | 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 101102984 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-hexyl-3,5-dihydro-2H-furo[3,2-c]quinolin-4-one |
| SMILES | CCCCCCC1Cc2c(c3ccccc3[nH]c2=O)O1 |
| InChI | InChI=1S/C17H21NO2/c1-2-3-4-5-8-12-11-14-16(20-12)13-9-6-7-10-15(13)18-17(14)19/h6-7,9-10,12H,2-5,8,11H2,1H3,(H,18,19) |
| InChIKey | UQCVDUDSWRNWIX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|