C12H11NO3 — CID 2784056
3-hydroxy-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one (PubChem CID 2784056) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-hydroxy-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one.
| Compound Name | 3-hydroxy-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 2784056 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-hydroxy-2,3,4,6-tetrahydropyrano[3,2-c]quinolin-5-one |
| SMILES | O=c1[nH]c2ccccc2c2c1CC(O)CO2 |
| InChI | InChI=1S/C12H11NO3/c14-7-5-9-11(16-6-7)8-3-1-2-4-10(8)13-12(9)15/h1-4,7,14H,5-6H2,(H,13,15) |
| InChIKey | GZPBDGVMDBROOW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |