C9H16O5 — CID 101103847
(1S,4R,5R)-4-hydroperoxy-1-methoxy-4-methyl-2,3-dioxabicyclo[3.3.1]nonane (PubChem CID 101103847) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1S,4R,5R)-4-hydroperoxy-1-methoxy-4-methyl-2,3-dioxabicyclo[3.3.1]nonane.
| Compound Name | (1S,4R,5R)-4-hydroperoxy-1-methoxy-4-methyl-2,3-dioxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 101103847 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (1S,4R,5R)-4-hydroperoxy-1-methoxy-4-methyl-2,3-dioxabicyclo[3.3.1]nonane |
| SMILES | CO[C@]12CCC[C@H](C1)[C@](C)(OO)OO2 |
| InChI | InChI=1S/C9H16O5/c1-8(12-10)7-4-3-5-9(6-7,11-2)14-13-8/h7,10H,3-6H2,1-2H3/t7-,8-,9+/m1/s1 |
| InChIKey | MYMLIGYUUXHIIZ-HLTSFMKQSA-N |
| XLogP | 1.69 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|