C18H26O6S — CID 101103914
[(2R)-4-(benzenesulfonyl)-2-hydroxy-5-oxooctyl] butanoate (PubChem CID 101103914) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(2R)-4-(benzenesulfonyl)-2-hydroxy-5-oxooctyl] butanoate.
| Compound Name | [(2R)-4-(benzenesulfonyl)-2-hydroxy-5-oxooctyl] butanoate |
|---|---|
| PubChem CID | 101103914 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(2R)-4-(benzenesulfonyl)-2-hydroxy-5-oxooctyl] butanoate |
| SMILES | CCCC(=O)OC[C@H](O)CC(C(=O)CCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O6S/c1-3-8-16(20)17(12-14(19)13-24-18(21)9-4-2)25(22,23)15-10-6-5-7-11-15/h5-7,10-11,14,17,19H,3-4,8-9,12-13H2,1-2H3/t14-,17?/m1/s1 |
| InChIKey | XSKPUEMPBLGXBL-XPCCGILXSA-N |
| XLogP | 2.29 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |