C14H18O5S — CID 24854550
(5S)-5-[4-(benzenesulfonyl)-3-hydroxybutyl]oxolan-2-one (PubChem CID 24854550) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is (5S)-5-[4-(benzenesulfonyl)-3-hydroxybutyl]oxolan-2-one.
| Compound Name | (5S)-5-[4-(benzenesulfonyl)-3-hydroxybutyl]oxolan-2-one |
|---|---|
| PubChem CID | 24854550 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (5S)-5-[4-(benzenesulfonyl)-3-hydroxybutyl]oxolan-2-one |
| SMILES | O=C1CC[C@H](CCC(O)CS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H18O5S/c15-11(6-7-12-8-9-14(16)19-12)10-20(17,18)13-4-2-1-3-5-13/h1-5,11-12,15H,6-10H2/t11?,12-/m0/s1 |
| InChIKey | TZKPYUSMCKHAOO-KIYNQFGBSA-N |
| XLogP | 1.31 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |