C15H21N3O — CID 101105415
cis-(1S,2R)-2-(4-azidobutyl)-1-phenylcyclopentan-1-ol (PubChem CID 101105415) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is cis-(1S,2R)-2-(4-azidobutyl)-1-phenylcyclopentan-1-ol.
| Compound Name | cis-(1S,2R)-2-(4-azidobutyl)-1-phenylcyclopentan-1-ol |
|---|---|
| PubChem CID | 101105415 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | cis-(1S,2R)-2-(4-azidobutyl)-1-phenylcyclopentan-1-ol |
| SMILES | [N-]=[N+]=NCCCC[C@@H]1CCC[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O/c16-18-17-12-5-4-9-14-10-6-11-15(14,19)13-7-2-1-3-8-13/h1-3,7-8,14,19H,4-6,9-12H2/t14-,15-/m1/s1 |
| InChIKey | ISRVAEFVXKGMQI-HUUCEWRRSA-N |
| XLogP | 4.15 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|