C18H22NO+ — CID 6946967
benzyl-[(1S,2R)-2-hydroxy-2-phenylcyclopentyl]azanium (PubChem CID 6946967) has the molecular formula C18H22NO+ and a molecular weight of 268.38 g/mol. Its IUPAC name is benzyl-[(1S,2R)-2-hydroxy-2-phenylcyclopentyl]azanium.
| Compound Name | benzyl-[(1S,2R)-2-hydroxy-2-phenylcyclopentyl]azanium |
|---|---|
| PubChem CID | 6946967 |
| Molecular Formula | C18H22NO+ |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | benzyl-[(1S,2R)-2-hydroxy-2-phenylcyclopentyl]azanium |
| SMILES | O[C@@]1(c2ccccc2)CCC[C@@H]1[NH2+]Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO/c20-18(16-10-5-2-6-11-16)13-7-12-17(18)19-14-15-8-3-1-4-9-15/h1-6,8-11,17,19-20H,7,12-14H2/p+1/t17-,18+/m0/s1 |
| InChIKey | GETWLPVVXVVUEZ-ZWKOTPCHSA-O |
| XLogP | 2.19 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |