C16H16F4N4O — CID 101107635
3-pyrrolidin-1-yl-5-(2,3,5,6-tetrafluoro-4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole (PubChem CID 101107635) has the molecular formula C16H16F4N4O and a molecular weight of 356.32 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-5-(2,3,5,6-tetrafluoro-4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-pyrrolidin-1-yl-5-(2,3,5,6-tetrafluoro-4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 101107635 |
| Molecular Formula | C16H16F4N4O |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-pyrrolidin-1-yl-5-(2,3,5,6-tetrafluoro-4-pyrrolidin-1-ylphenyl)-1,2,4-oxadiazole |
| SMILES | Fc1c(F)c(N2CCCC2)c(F)c(F)c1-c1nc(N2CCCC2)no1 |
| InChI | InChI=1S/C16H16F4N4O/c17-10-9(15-21-16(22-25-15)24-7-3-4-8-24)11(18)13(20)14(12(10)19)23-5-1-2-6-23/h1-8H2 |
| InChIKey | NBAKXKDMCBKUKF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|