C11H15N5OS — CID 116808037
4-[3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-amine (PubChem CID 116808037) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-[3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 116808037 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[3-(azepan-1-yl)-1,2,4-oxadiazol-5-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2nc(N3CCCCCC3)no2)cs1 |
| InChI | InChI=1S/C11H15N5OS/c12-10-13-8(7-18-10)9-14-11(15-17-9)16-5-3-1-2-4-6-16/h7H,1-6H2,(H2,12,13) |
| InChIKey | GABVMOBPWKYVGO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |