C20H30O3 — CID 101109037
(1S,4aS,5R,8aR)-5-[(Z)-3-formyl-4-methylpent-2-enyl]-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde (PubChem CID 101109037) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,4aS,5R,8aR)-5-[(Z)-3-formyl-4-methylpent-2-enyl]-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,4aS,5R,8aR)-5-[(Z)-3-formyl-4-methylpent-2-enyl]-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 101109037 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,4aS,5R,8aR)-5-[(Z)-3-formyl-4-methylpent-2-enyl]-1,4a-dimethyl-6-oxo-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
| SMILES | CC(C)/C(C=O)=C/C[C@H]1C(=O)CC[C@@H]2[C@]1(C)CCC[C@]2(C)C=O |
| InChI | InChI=1S/C20H30O3/c1-14(2)15(12-21)6-7-16-17(23)8-9-18-19(3,13-22)10-5-11-20(16,18)4/h6,12-14,16,18H,5,7-11H2,1-4H3/b15-6+/t16-,18-,19+,20+/m0/s1 |
| InChIKey | DMFGOABZYZPFTC-DJYYAVDMSA-N |
| XLogP | 4.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|