C14H22O6 — CID 101109395
dimethyl 2-[(E,1R)-1-butanoyloxybut-2-enyl]-2-methylpropanedioate (PubChem CID 101109395) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is dimethyl 2-[(E,1R)-1-butanoyloxybut-2-enyl]-2-methylpropanedioate.
| Compound Name | dimethyl 2-[(E,1R)-1-butanoyloxybut-2-enyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 101109395 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | dimethyl 2-[(E,1R)-1-butanoyloxybut-2-enyl]-2-methylpropanedioate |
| SMILES | C/C=C/[C@@H](OC(=O)CCC)C(C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H22O6/c1-6-8-10(20-11(15)9-7-2)14(3,12(16)18-4)13(17)19-5/h6,8,10H,7,9H2,1-5H3/b8-6+/t10-/m1/s1 |
| InChIKey | WNTCBUBGSCPGSY-QEHWCHDUSA-N |
| XLogP | 1.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|