C30H24Br2O2 — CID 101109663
[(1R,2S,4R,5S)-4,5-bis(3-bromophenyl)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone (PubChem CID 101109663) has the molecular formula C30H24Br2O2 and a molecular weight of 576.33 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-4,5-bis(3-bromophenyl)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone.
| Compound Name | [(1R,2S,4R,5S)-4,5-bis(3-bromophenyl)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 101109663 |
| Molecular Formula | C30H24Br2O2 |
| Molecular Weight | 576.33 g/mol |
| Exact Mass | 574.01 |
| IUPAC Name | [(1R,2S,4R,5S)-4,5-bis(3-bromophenyl)-2-hydroxy-2-phenylcyclopentyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](c2cccc(Br)c2)[C@H](c2cccc(Br)c2)C[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C30H24Br2O2/c31-24-15-7-11-21(17-24)26-19-30(34,23-13-5-2-6-14-23)28(29(33)20-9-3-1-4-10-20)27(26)22-12-8-16-25(32)18-22/h1-18,26-28,34H,19H2/t26-,27-,28-,30+/m0/s1 |
| InChIKey | VHQDAXXMJQJPJH-VNDOHOEKSA-N |
| XLogP | 7.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.33 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |