C23H34N2O3 — CID 101112858
tert-butyl (2S)-6-oxo-5-pentyl-3-phenyl-2-propan-2-yl-2,5-dihydropyrazine-1-carboxylate (PubChem CID 101112858) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is tert-butyl (2S)-6-oxo-5-pentyl-3-phenyl-2-propan-2-yl-2,5-dihydropyrazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-6-oxo-5-pentyl-3-phenyl-2-propan-2-yl-2,5-dihydropyrazine-1-carboxylate |
|---|---|
| PubChem CID | 101112858 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | tert-butyl (2S)-6-oxo-5-pentyl-3-phenyl-2-propan-2-yl-2,5-dihydropyrazine-1-carboxylate |
| SMILES | CCCCCC1N=C(c2ccccc2)[C@H](C(C)C)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C23H34N2O3/c1-7-8-10-15-18-21(26)25(22(27)28-23(4,5)6)20(16(2)3)19(24-18)17-13-11-9-12-14-17/h9,11-14,16,18,20H,7-8,10,15H2,1-6H3/t18?,20-/m0/s1 |
| InChIKey | UBXWUGGBSHDFTF-IJHRGXPZSA-N |
| XLogP | 5.23 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|