C19H23F3N2O3 — CID 171843821
tert-butyl (NZ)-N-[(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-ylidene]carbamate (PubChem CID 171843821) has the molecular formula C19H23F3N2O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-ylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-ylidene]carbamate |
|---|---|
| PubChem CID | 171843821 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | tert-butyl (NZ)-N-[(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-ylidene]carbamate |
| SMILES | C[C@@H]1[C@H](c2ccccc2)C/C(=N/C(=O)OC(C)(C)C)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C19H23F3N2O3/c1-12-14(13-8-6-5-7-9-13)10-15(23-17(26)27-18(2,3)4)16(25)24(12)11-19(20,21)22/h5-9,12,14H,10-11H2,1-4H3/b23-15-/t12-,14-/m1/s1 |
| InChIKey | IUGLTDIRRSARSO-PNMTZTDFSA-N |
| XLogP | 4.33 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|