C20H27F3N2O3 — CID 52746343
tert-butyl 4-[(3S)-3-[4-(trifluoromethyl)phenyl]butanoyl]piperazine-1-carboxylate (PubChem CID 52746343) has the molecular formula C20H27F3N2O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is tert-butyl 4-[(3S)-3-[4-(trifluoromethyl)phenyl]butanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3S)-3-[4-(trifluoromethyl)phenyl]butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 52746343 |
| Molecular Formula | C20H27F3N2O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl 4-[(3S)-3-[4-(trifluoromethyl)phenyl]butanoyl]piperazine-1-carboxylate |
| SMILES | C[C@@H](CC(=O)N1CCN(C(=O)OC(C)(C)C)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H27F3N2O3/c1-14(15-5-7-16(8-6-15)20(21,22)23)13-17(26)24-9-11-25(12-10-24)18(27)28-19(2,3)4/h5-8,14H,9-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | WRUJFHMMEZLXCG-AWEZNQCLSA-N |
| XLogP | 4.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |