C18H34INO3Si2 — CID 101113902
(1R,4R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-iodocyclopent-2-ene-1-carbonitrile (PubChem CID 101113902) has the molecular formula C18H34INO3Si2 and a molecular weight of 495.55 g/mol. Its IUPAC name is (1R,4R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-iodocyclopent-2-ene-1-carbonitrile.
| Compound Name | (1R,4R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-iodocyclopent-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 101113902 |
| Molecular Formula | C18H34INO3Si2 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (1R,4R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-2-iodocyclopent-2-ene-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)C=C(I)[C@]1(C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34INO3Si2/c1-16(2,3)24(7,8)22-15-13(21)11-14(19)18(15,12-20)23-25(9,10)17(4,5)6/h11,13,15,21H,1-10H3/t13-,15+,18+/m1/s1 |
| InChIKey | YIKJHJRSORIKBD-XUWXXGDYSA-N |
| XLogP | 5.35 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|