C18H37IO4Si2 — CID 101113903
(1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodocyclopent-4-ene-1,3-diol (PubChem CID 101113903) has the molecular formula C18H37IO4Si2 and a molecular weight of 500.57 g/mol. Its IUPAC name is (1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodocyclopent-4-ene-1,3-diol.
| Compound Name | (1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodocyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 101113903 |
| Molecular Formula | C18H37IO4Si2 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodocyclopent-4-ene-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(O)C(I)=C[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H37IO4Si2/c1-16(2,3)24(7,8)22-12-18(21)14(19)11-13(20)15(18)23-25(9,10)17(4,5)6/h11,13,15,20-21H,12H2,1-10H3/t13-,15+,18+/m1/s1 |
| InChIKey | QOVVJOGYESUAJR-XUWXXGDYSA-N |
| XLogP | 4.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|