C14H23IO3Si — CID 11153610
(1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-hydroxyprop-2-ynyl]-2-iodocyclopent-2-en-1-ol (PubChem CID 11153610) has the molecular formula C14H23IO3Si and a molecular weight of 394.33 g/mol. Its IUPAC name is (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-hydroxyprop-2-ynyl]-2-iodocyclopent-2-en-1-ol.
| Compound Name | (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-hydroxyprop-2-ynyl]-2-iodocyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11153610 |
| Molecular Formula | C14H23IO3Si |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-hydroxyprop-2-ynyl]-2-iodocyclopent-2-en-1-ol |
| SMILES | C#C[C@@H](O)[C@@]1(O)C[C@H](O[Si](C)(C)C(C)(C)C)C=C1I |
| InChI | InChI=1S/C14H23IO3Si/c1-7-12(16)14(17)9-10(8-11(14)15)18-19(5,6)13(2,3)4/h1,8,10,12,16-17H,9H2,2-6H3/t10-,12-,14-/m1/s1 |
| InChIKey | MWHYZLPATQPCKQ-MPKXVKKWSA-N |
| XLogP | 2.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|