C23H45IO3Si3 — CID 15406299
(1S)-1-[(1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 15406299) has the molecular formula C23H45IO3Si3 and a molecular weight of 580.77 g/mol. Its IUPAC name is (1S)-1-[(1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1S)-1-[(1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 15406299 |
| Molecular Formula | C23H45IO3Si3 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (1S)-1-[(1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(I)[C@@](O[Si](C)(C)C(C)(C)C)([C@@H](O)C#C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C23H45IO3Si3/c1-21(2,3)29(10,11)26-18-16-19(24)23(17-18,20(25)14-15-28(7,8)9)27-30(12,13)22(4,5)6/h16,18,20,25H,17H2,1-13H3/t18-,20+,23-/m1/s1 |
| InChIKey | FAYVRTYCRAJOHY-QMHWCDLVSA-N |
| XLogP | 7.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|