C18H38O4Si — CID 10043267
(E,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyldec-5-ene-1,2,4-triol (PubChem CID 10043267) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is (E,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyldec-5-ene-1,2,4-triol.
| Compound Name | (E,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyldec-5-ene-1,2,4-triol |
|---|---|
| PubChem CID | 10043267 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (E,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyldec-5-ene-1,2,4-triol |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/[C@@H](O)CC(O)CO |
| InChI | InChI=1S/C18H38O4Si/c1-13(2)17(22-23(7,8)18(4,5)6)14(3)9-10-15(20)11-16(21)12-19/h9-10,13-17,19-21H,11-12H2,1-8H3/b10-9+/t14-,15-,16?,17-/m1/s1 |
| InChIKey | LTWNSRCSDRNQQI-YGZLYHSGSA-N |
| XLogP | 3.33 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|