C17H35IO3Si2 — CID 10885183
(1S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-ol (PubChem CID 10885183) has the molecular formula C17H35IO3Si2 and a molecular weight of 470.54 g/mol. Its IUPAC name is (1S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-ol.
| Compound Name | (1S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10885183 |
| Molecular Formula | C17H35IO3Si2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (1S,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C=C(I)[C@H]1O |
| InChI | InChI=1S/C17H35IO3Si2/c1-16(2,3)22(7,8)20-13-11-12(18)14(19)15(13)21-23(9,10)17(4,5)6/h11,13-15,19H,1-10H3/t13-,14+,15+/m0/s1 |
| InChIKey | XCSHKIIMTHKHND-RRFJBIMHSA-N |
| XLogP | 5.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|