C24H22ClNO2 — CID 101117320
(2S)-2-chloro-2-[(4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol (PubChem CID 101117320) has the molecular formula C24H22ClNO2 and a molecular weight of 391.90 g/mol. Its IUPAC name is (2S)-2-chloro-2-[(4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol.
| Compound Name | (2S)-2-chloro-2-[(4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol |
|---|---|
| PubChem CID | 101117320 |
| Molecular Formula | C24H22ClNO2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (2S)-2-chloro-2-[(4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1-diphenylethanol |
| SMILES | C[C@@H]1N=C([C@@H](Cl)C(O)(c2ccccc2)c2ccccc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22ClNO2/c1-17-21(18-11-5-2-6-12-18)28-23(26-17)22(25)24(27,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,21-22,27H,1H3/t17-,21-,22+/m0/s1 |
| InChIKey | AAKDZSZBGMCWEC-BULFRSBZSA-N |
| XLogP | 5.09 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|